C22H18N8O4S2 — CID 135805971
ethyl 7-(4-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135805971) has the molecular formula C22H18N8O4S2 and a molecular weight of 522.57 g/mol. Its IUPAC name is ethyl 7-(4-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-(4-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135805971 |
| Molecular Formula | C22H18N8O4S2 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | ethyl 7-(4-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(CSc2nnc(-c3ccccc3)s2)Nc2nnnn2C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18N8O4S2/c1-2-34-20(31)17-16(12-35-22-26-24-19(36-22)14-6-4-3-5-7-14)23-21-25-27-28-29(21)18(17)13-8-10-15(11-9-13)30(32)33/h3-11,18H,2,12H2,1H3,(H,23,25,28) |
| InChIKey | RLXDROJKVMLYKI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 150.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|