C26H27N7O4S2 — CID 135806008
ethyl 7-(3,4-diethoxyphenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135806008) has the molecular formula C26H27N7O4S2 and a molecular weight of 565.68 g/mol. Its IUPAC name is ethyl 7-(3,4-diethoxyphenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-(3,4-diethoxyphenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135806008 |
| Molecular Formula | C26H27N7O4S2 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | ethyl 7-(3,4-diethoxyphenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(CSc2nnc(-c3ccccc3)s2)Nc2nnnn2C1c1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C26H27N7O4S2/c1-4-35-19-13-12-17(14-20(19)36-5-2)22-21(24(34)37-6-3)18(27-25-29-31-32-33(22)25)15-38-26-30-28-23(39-26)16-10-8-7-9-11-16/h7-14,22H,4-6,15H2,1-3H3,(H,27,29,32) |
| InChIKey | MFJKTKNTQMHMMH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |