C21H16N8O4S2 — CID 135805843
methyl 7-(3-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135805843) has the molecular formula C21H16N8O4S2 and a molecular weight of 508.55 g/mol. Its IUPAC name is methyl 7-(3-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 7-(3-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135805843 |
| Molecular Formula | C21H16N8O4S2 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | methyl 7-(3-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(CSc2nnc(-c3ccccc3)s2)Nc2nnnn2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H16N8O4S2/c1-33-19(30)16-15(11-34-21-25-23-18(35-21)12-6-3-2-4-7-12)22-20-24-26-27-28(20)17(16)13-8-5-9-14(10-13)29(31)32/h2-10,17H,11H2,1H3,(H,22,24,27) |
| InChIKey | ZMXNATHYUCBBQN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 150.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|