C23H21N7O4S2 — CID 135805876
methyl 7-(2,4-dimethoxyphenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135805876) has the molecular formula C23H21N7O4S2 and a molecular weight of 523.60 g/mol. Its IUPAC name is methyl 7-(2,4-dimethoxyphenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 7-(2,4-dimethoxyphenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135805876 |
| Molecular Formula | C23H21N7O4S2 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | methyl 7-(2,4-dimethoxyphenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(CSc2nnc(-c3ccccc3)s2)Nc2nnnn2C1c1ccc(OC)cc1OC |
| InChI | InChI=1S/C23H21N7O4S2/c1-32-14-9-10-15(17(11-14)33-2)19-18(21(31)34-3)16(24-22-26-28-29-30(19)22)12-35-23-27-25-20(36-23)13-7-5-4-6-8-13/h4-11,19H,12H2,1-3H3,(H,24,26,29) |
| InChIKey | RPCFFQZKRLSVJL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |