C23H20N8O5S2 — CID 135805974
ethyl 7-(4-methoxy-3-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135805974) has the molecular formula C23H20N8O5S2 and a molecular weight of 552.60 g/mol. Its IUPAC name is ethyl 7-(4-methoxy-3-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-(4-methoxy-3-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135805974 |
| Molecular Formula | C23H20N8O5S2 |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | ethyl 7-(4-methoxy-3-nitrophenyl)-5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(CSc2nnc(-c3ccccc3)s2)Nc2nnnn2C1c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20N8O5S2/c1-3-36-21(32)18-15(12-37-23-27-25-20(38-23)13-7-5-4-6-8-13)24-22-26-28-29-30(22)19(18)14-9-10-17(35-2)16(11-14)31(33)34/h4-11,19H,3,12H2,1-2H3,(H,24,26,29) |
| InChIKey | UMDJISWSVUBMJV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 160.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|