C24H23N7O5S2 — CID 135805881
methyl 5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-7-(3,4,5-trimethoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135805881) has the molecular formula C24H23N7O5S2 and a molecular weight of 553.63 g/mol. Its IUPAC name is methyl 5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-7-(3,4,5-trimethoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-7-(3,4,5-trimethoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135805881 |
| Molecular Formula | C24H23N7O5S2 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | methyl 5-[(5-phenyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-7-(3,4,5-trimethoxyphenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(CSc2nnc(-c3ccccc3)s2)Nc2nnnn2C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H23N7O5S2/c1-33-16-10-14(11-17(34-2)20(16)35-3)19-18(22(32)36-4)15(25-23-27-29-30-31(19)23)12-37-24-28-26-21(38-24)13-8-6-5-7-9-13/h5-11,19H,12H2,1-4H3,(H,25,27,30) |
| InChIKey | MQGDWMDMHPUMMI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |