C15H11BrN4O2S — CID 133379838
2-bromo-4-nitro-N-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]aniline (PubChem CID 133379838) has the molecular formula C15H11BrN4O2S and a molecular weight of 391.25 g/mol. Its IUPAC name is 2-bromo-4-nitro-N-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]aniline.
| Compound Name | 2-bromo-4-nitro-N-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 133379838 |
| Molecular Formula | C15H11BrN4O2S |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 2-bromo-4-nitro-N-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(NCc2nnc(-c3ccccc3)s2)c(Br)c1 |
| InChI | InChI=1S/C15H11BrN4O2S/c16-12-8-11(20(21)22)6-7-13(12)17-9-14-18-19-15(23-14)10-4-2-1-3-5-10/h1-8,17H,9H2 |
| InChIKey | LQVADJXBWHVENF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|