C18H13N5O2S — CID 133379936
6-nitro-N-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]quinolin-2-amine (PubChem CID 133379936) has the molecular formula C18H13N5O2S and a molecular weight of 363.40 g/mol. Its IUPAC name is 6-nitro-N-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]quinolin-2-amine.
| Compound Name | 6-nitro-N-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]quinolin-2-amine |
|---|---|
| PubChem CID | 133379936 |
| Molecular Formula | C18H13N5O2S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 6-nitro-N-[(5-phenyl-1,3,4-thiadiazol-2-yl)methyl]quinolin-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(NCc3nnc(-c4ccccc4)s3)ccc2c1 |
| InChI | InChI=1S/C18H13N5O2S/c24-23(25)14-7-8-15-13(10-14)6-9-16(20-15)19-11-17-21-22-18(26-17)12-4-2-1-3-5-12/h1-10H,11H2,(H,19,20) |
| InChIKey | ZXFBVYSDDJBQMX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|