C15H13N5O4S2 — CID 133379886
5-nitro-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)methylamino]benzenesulfonamide (PubChem CID 133379886) has the molecular formula C15H13N5O4S2 and a molecular weight of 391.43 g/mol. Its IUPAC name is 5-nitro-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)methylamino]benzenesulfonamide.
| Compound Name | 5-nitro-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 133379886 |
| Molecular Formula | C15H13N5O4S2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 5-nitro-2-[(5-phenyl-1,3,4-thiadiazol-2-yl)methylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc([N+](=O)[O-])ccc1NCc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C15H13N5O4S2/c16-26(23,24)13-8-11(20(21)22)6-7-12(13)17-9-14-18-19-15(25-14)10-4-2-1-3-5-10/h1-8,17H,9H2,(H2,16,23,24) |
| InChIKey | OBIYKAXLYUIFCN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|