C19H18N4O3 — CID 133279470
N-benzyl-3-[(6-nitroquinolin-2-yl)amino]propanamide (PubChem CID 133279470) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-benzyl-3-[(6-nitroquinolin-2-yl)amino]propanamide.
| Compound Name | N-benzyl-3-[(6-nitroquinolin-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 133279470 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-benzyl-3-[(6-nitroquinolin-2-yl)amino]propanamide |
| SMILES | O=C(CCNc1ccc2cc([N+](=O)[O-])ccc2n1)NCc1ccccc1 |
| InChI | InChI=1S/C19H18N4O3/c24-19(21-13-14-4-2-1-3-5-14)10-11-20-18-9-6-15-12-16(23(25)26)7-8-17(15)22-18/h1-9,12H,10-11,13H2,(H,20,22)(H,21,24) |
| InChIKey | PKXWWLAXUNPSOH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|