C11H4N6O6S3 — CID 140985458
2-(2,4-dinitrophenyl)-5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole (PubChem CID 140985458) has the molecular formula C11H4N6O6S3 and a molecular weight of 412.39 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole.
| Compound Name | 2-(2,4-dinitrophenyl)-5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 140985458 |
| Molecular Formula | C11H4N6O6S3 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc(Sc3ncc([N+](=O)[O-])s3)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H4N6O6S3/c18-15(19)5-1-2-6(7(3-5)16(20)21)9-13-14-11(25-9)26-10-12-4-8(24-10)17(22)23/h1-4H |
| InChIKey | KSMLGHXQSXRAGZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 168.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|