C8HCl4N3O2S2 — CID 21325006
5-nitro-2-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]-1,3-thiazole (PubChem CID 21325006) has the molecular formula C8HCl4N3O2S2 and a molecular weight of 377.06 g/mol. Its IUPAC name is 5-nitro-2-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]-1,3-thiazole.
| Compound Name | 5-nitro-2-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 21325006 |
| Molecular Formula | C8HCl4N3O2S2 |
| Molecular Weight | 377.06 g/mol |
| Exact Mass | 374.83 |
| IUPAC Name | 5-nitro-2-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cnc(Sc2c(Cl)c(Cl)nc(Cl)c2Cl)s1 |
| InChI | InChI=1S/C8HCl4N3O2S2/c9-3-5(4(10)7(12)14-6(3)11)19-8-13-1-2(18-8)15(16)17/h1H |
| InChIKey | XYGOQCKARYMZIC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.06 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|