C10Cl8N2S — CID 12580108
2,3,5,6-tetrachloro-4-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]pyridine (PubChem CID 12580108) has the molecular formula C10Cl8N2S and a molecular weight of 463.82 g/mol. Its IUPAC name is 2,3,5,6-tetrachloro-4-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]pyridine.
| Compound Name | 2,3,5,6-tetrachloro-4-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]pyridine |
|---|---|
| PubChem CID | 12580108 |
| Molecular Formula | C10Cl8N2S |
| Molecular Weight | 463.82 g/mol |
| Exact Mass | 459.73 |
| IUPAC Name | 2,3,5,6-tetrachloro-4-[(2,3,5,6-tetrachloro-4-pyridinyl)sulfanyl]pyridine |
| SMILES | Clc1nc(Cl)c(Cl)c(Sc2c(Cl)c(Cl)nc(Cl)c2Cl)c1Cl |
| InChI | InChI=1S/C10Cl8N2S/c11-1-5(2(12)8(16)19-7(1)15)21-6-3(13)9(17)20-10(18)4(6)14 |
| InChIKey | GJZRLTUZBGLKIL-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.82 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|