C11H6N4O3S2 — CID 135997718
2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-3H-quinazolin-4-one (PubChem CID 135997718) has the molecular formula C11H6N4O3S2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135997718 |
| Molecular Formula | C11H6N4O3S2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(Sc2ncc([N+](=O)[O-])s2)nc2ccccc12 |
| InChI | InChI=1S/C11H6N4O3S2/c16-9-6-3-1-2-4-7(6)13-10(14-9)20-11-12-5-8(19-11)15(17)18/h1-5H,(H,13,14,16) |
| InChIKey | PLRTYPWAUJAXBO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|