C20H19N5O9S — CID 136632897
2-(3,3-dimethyl-2-oxobutyl)sulfanyl-3H-quinazolin-4-one;2,4,6-trinitrophenol (PubChem CID 136632897) has the molecular formula C20H19N5O9S and a molecular weight of 505.47 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2-oxobutyl)sulfanyl-3H-quinazolin-4-one;2,4,6-trinitrophenol.
| Compound Name | 2-(3,3-dimethyl-2-oxobutyl)sulfanyl-3H-quinazolin-4-one;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 136632897 |
| Molecular Formula | C20H19N5O9S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 2-(3,3-dimethyl-2-oxobutyl)sulfanyl-3H-quinazolin-4-one;2,4,6-trinitrophenol |
| SMILES | CC(C)(C)C(=O)CSc1nc2ccccc2c(=O)[nH]1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N2O2S.C6H3N3O7/c1-14(2,3)11(17)8-19-13-15-10-7-5-4-6-9(10)12(18)16-13;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h4-7H,8H2,1-3H3,(H,15,16,18);1-2,10H |
| InChIKey | QKTMIGZPKSHPPL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 212.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|