C18H12N4O5S2 — CID 4264719
2-[5-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]isoindole-1,3-dione (PubChem CID 4264719) has the molecular formula C18H12N4O5S2 and a molecular weight of 428.45 g/mol. Its IUPAC name is 2-[5-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[5-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4264719 |
| Molecular Formula | C18H12N4O5S2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 2-[5-[(2-methoxy-5-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]isoindole-1,3-dione |
| SMILES | COc1ccc([N+](=O)[O-])cc1CSc1nnc(N2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C18H12N4O5S2/c1-27-14-7-6-11(22(25)26)8-10(14)9-28-18-20-19-17(29-18)21-15(23)12-4-2-3-5-13(12)16(21)24/h2-8H,9H2,1H3 |
| InChIKey | SWMRTZAPWYACDA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 115.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|