About 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole
1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole (PubChem CID 116621762) has the molecular formula C12H12N4O4
and a molecular weight of 276.25 g/mol. Its IUPAC name is 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole.
Molecular Properties
| Compound Name | 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole |
| PubChem CID | 116621762 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole |
| SMILES | Cc1ncn(Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H12N4O4/c1-8-9(2)14(7-13-8)6-10-3-4-11(15(17)18)5-12(10)16(19)20/h3-5,7H,6H2,1-2H3 |
| InChIKey | LHARJXWKTVZIDW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole?
The IUPAC name of 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole (CID 116621762) is 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole.
What is the SMILES notation for 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole?
The canonical SMILES for 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole is Cc1ncn(Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1C.
What is the InChIKey of 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole?
The InChIKey is LHARJXWKTVZIDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O4/c1-8-9(2)14(7-13-8)6-10-3-4-11(15(17)18)5-12(10)16(19)20/h3-5,7H,6H2,1-2H3.
What are the key properties of 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole?
1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole has a molecular weight of 276.25 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole is sourced from PubChem (CID 116621762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).