C12H12N4O4 — CID 116621762
1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole (PubChem CID 116621762) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole.
| Compound Name | 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole |
|---|---|
| PubChem CID | 116621762 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 1-[(2,4-dinitrophenyl)methyl]-4,5-dimethylimidazole |
| SMILES | Cc1ncn(Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H12N4O4/c1-8-9(2)14(7-13-8)6-10-3-4-11(15(17)18)5-12(10)16(19)20/h3-5,7H,6H2,1-2H3 |
| InChIKey | LHARJXWKTVZIDW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|