C10H9N5O5 — CID 66223519
[2-[(2,4-dinitrophenyl)methyl]-1,2,4-triazol-3-yl]methanol (PubChem CID 66223519) has the molecular formula C10H9N5O5 and a molecular weight of 279.21 g/mol. Its IUPAC name is [2-[(2,4-dinitrophenyl)methyl]-1,2,4-triazol-3-yl]methanol.
| Compound Name | [2-[(2,4-dinitrophenyl)methyl]-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 66223519 |
| Molecular Formula | C10H9N5O5 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | [2-[(2,4-dinitrophenyl)methyl]-1,2,4-triazol-3-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc(Cn2ncnc2CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H9N5O5/c16-5-10-11-6-12-13(10)4-7-1-2-8(14(17)18)3-9(7)15(19)20/h1-3,6,16H,4-5H2 |
| InChIKey | PABKECWGZVQJMK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|