C11H10N4O5 — CID 106717250
[1-[(2,4-dinitrophenyl)methyl]imidazol-4-yl]methanol (PubChem CID 106717250) has the molecular formula C11H10N4O5 and a molecular weight of 278.22 g/mol. Its IUPAC name is [1-[(2,4-dinitrophenyl)methyl]imidazol-4-yl]methanol.
| Compound Name | [1-[(2,4-dinitrophenyl)methyl]imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 106717250 |
| Molecular Formula | C11H10N4O5 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | [1-[(2,4-dinitrophenyl)methyl]imidazol-4-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc(Cn2cnc(CO)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10N4O5/c16-6-9-5-13(7-12-9)4-8-1-2-10(14(17)18)3-11(8)15(19)20/h1-3,5,7,16H,4,6H2 |
| InChIKey | MAGSXVIXMNSNBC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|