C22H28N8O4S — CID 29340654
N-[4-(dimethylsulfamoyl)phenyl]-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine-1-carboxamide (PubChem CID 29340654) has the molecular formula C22H28N8O4S and a molecular weight of 500.59 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine-1-carboxamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 29340654 |
| Molecular Formula | C22H28N8O4S |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(-n2nnnc2CN2CCN(C(=O)Nc3ccc(S(=O)(=O)N(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H28N8O4S/c1-27(2)35(32,33)20-10-4-17(5-11-20)23-22(31)29-14-12-28(13-15-29)16-21-24-25-26-30(21)18-6-8-19(34-3)9-7-18/h4-11H,12-16H2,1-3H3,(H,23,31) |
| InChIKey | NHMSFWHMOPBUSR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'tetrazole_A(1)', 'substructure': 'N/A'} |
|---|