C18H25ClN6O2 — CID 30938356
3-chloro-1-[4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 30938356) has the molecular formula C18H25ClN6O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is 3-chloro-1-[4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-[4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 30938356 |
| Molecular Formula | C18H25ClN6O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-chloro-1-[4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1ccc(-n2nnnc2CN2CCN(C(=O)C(C)(C)CCl)CC2)cc1 |
| InChI | InChI=1S/C18H25ClN6O2/c1-18(2,13-19)17(26)24-10-8-23(9-11-24)12-16-20-21-22-25(16)14-4-6-15(27-3)7-5-14/h4-7H,8-13H2,1-3H3 |
| InChIKey | OKMOVDJKDRILDW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'tetrazole_A(1)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|