C20H21N7O4 — CID 30938424
[4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-nitrophenyl)methanone (PubChem CID 30938424) has the molecular formula C20H21N7O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is [4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-nitrophenyl)methanone.
| Compound Name | [4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 30938424 |
| Molecular Formula | C20H21N7O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-nitrophenyl)methanone |
| SMILES | COc1ccc(-n2nnnc2CN2CCN(C(=O)c3ccccc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C20H21N7O4/c1-31-16-8-6-15(7-9-16)26-19(21-22-23-26)14-24-10-12-25(13-11-24)20(28)17-4-2-3-5-18(17)27(29)30/h2-9H,10-14H2,1H3 |
| InChIKey | JGBQRBSKKCECOR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'tetrazole_A(1)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|