C20H20FN7O3 — CID 30937139
[4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-methyl-3-nitrophenyl)methanone (PubChem CID 30937139) has the molecular formula C20H20FN7O3 and a molecular weight of 425.42 g/mol. Its IUPAC name is [4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-methyl-3-nitrophenyl)methanone.
| Compound Name | [4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 30937139 |
| Molecular Formula | C20H20FN7O3 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [4-[[1-(4-fluorophenyl)tetrazol-5-yl]methyl]piperazin-1-yl]-(2-methyl-3-nitrophenyl)methanone |
| SMILES | Cc1c(C(=O)N2CCN(Cc3nnnn3-c3ccc(F)cc3)CC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20FN7O3/c1-14-17(3-2-4-18(14)28(30)31)20(29)26-11-9-25(10-12-26)13-19-22-23-24-27(19)16-7-5-15(21)6-8-16/h2-8H,9-13H2,1H3 |
| InChIKey | VMRJCACOBRGJMF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|