C19H27N7O4 — CID 29340628
ethyl 3-[[4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine-1-carbonyl]amino]propanoate (PubChem CID 29340628) has the molecular formula C19H27N7O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is ethyl 3-[[4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine-1-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine-1-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 29340628 |
| Molecular Formula | C19H27N7O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | ethyl 3-[[4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine-1-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)N1CCN(Cc2nnnn2-c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C19H27N7O4/c1-3-30-18(27)8-9-20-19(28)25-12-10-24(11-13-25)14-17-21-22-23-26(17)15-4-6-16(29-2)7-5-15/h4-7H,3,8-14H2,1-2H3,(H,20,28) |
| InChIKey | GQLLCERFGHTSPS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'tetrazole_A(1)', 'substructure': 'N/A'} |
|---|