C13H15N5O3S — CID 119071240
1,1-dioxo-N-[(1-phenyltetrazol-5-yl)methyl]thiolane-3-carboxamide (PubChem CID 119071240) has the molecular formula C13H15N5O3S and a molecular weight of 321.36 g/mol. Its IUPAC name is 1,1-dioxo-N-[(1-phenyltetrazol-5-yl)methyl]thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-[(1-phenyltetrazol-5-yl)methyl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 119071240 |
| Molecular Formula | C13H15N5O3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1,1-dioxo-N-[(1-phenyltetrazol-5-yl)methyl]thiolane-3-carboxamide |
| SMILES | O=C(NCc1nnnn1-c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15N5O3S/c19-13(10-6-7-22(20,21)9-10)14-8-12-15-16-17-18(12)11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H,14,19) |
| InChIKey | VLXCLYUSSIRKIA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |