C18H26ClN5O — CID 119916715
N-(2-aminoethyl)-1-[(1-phenylpyrazol-4-yl)methyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119916715) has the molecular formula C18H26ClN5O and a molecular weight of 363.89 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[(1-phenylpyrazol-4-yl)methyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-[(1-phenylpyrazol-4-yl)methyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119916715 |
| Molecular Formula | C18H26ClN5O |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-(2-aminoethyl)-1-[(1-phenylpyrazol-4-yl)methyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)C1CCCN(Cc2cnn(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C18H25N5O.ClH/c19-8-9-20-18(24)16-5-4-10-22(14-16)12-15-11-21-23(13-15)17-6-2-1-3-7-17;/h1-3,6-7,11,13,16H,4-5,8-10,12,14,19H2,(H,20,24);1H |
| InChIKey | DERPRIPKTKXBOI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |