C17H25N3O3 — CID 120837370
methyl 3-[[3-(2-aminoethylcarbamoyl)piperidin-1-yl]methyl]benzoate (PubChem CID 120837370) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is methyl 3-[[3-(2-aminoethylcarbamoyl)piperidin-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[3-(2-aminoethylcarbamoyl)piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 120837370 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | methyl 3-[[3-(2-aminoethylcarbamoyl)piperidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(CN2CCCC(C(=O)NCCN)C2)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-23-17(22)14-5-2-4-13(10-14)11-20-9-3-6-15(12-20)16(21)19-8-7-18/h2,4-5,10,15H,3,6-9,11-12,18H2,1H3,(H,19,21) |
| InChIKey | AFDUCGMRGALVJF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |