C13H23N7O — CID 63252804
N-(2-aminoethyl)-1-[(1-cyclopropyltetrazol-5-yl)methyl]piperidine-3-carboxamide (PubChem CID 63252804) has the molecular formula C13H23N7O and a molecular weight of 293.38 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[(1-cyclopropyltetrazol-5-yl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[(1-cyclopropyltetrazol-5-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 63252804 |
| Molecular Formula | C13H23N7O |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N-(2-aminoethyl)-1-[(1-cyclopropyltetrazol-5-yl)methyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(Cc2nnnn2C2CC2)C1 |
| InChI | InChI=1S/C13H23N7O/c14-5-6-15-13(21)10-2-1-7-19(8-10)9-12-16-17-18-20(12)11-3-4-11/h10-11H,1-9,14H2,(H,15,21) |
| InChIKey | ZIZYIOSIFUFVPA-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |