C17H25ClN4 — CID 120841155
[3-methyl-1-[(1-phenylimidazol-2-yl)methyl]piperidin-2-yl]methanamine;hydrochloride (PubChem CID 120841155) has the molecular formula C17H25ClN4 and a molecular weight of 320.87 g/mol. Its IUPAC name is [3-methyl-1-[(1-phenylimidazol-2-yl)methyl]piperidin-2-yl]methanamine;hydrochloride.
| Compound Name | [3-methyl-1-[(1-phenylimidazol-2-yl)methyl]piperidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120841155 |
| Molecular Formula | C17H25ClN4 |
| Molecular Weight | 320.87 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | [3-methyl-1-[(1-phenylimidazol-2-yl)methyl]piperidin-2-yl]methanamine;hydrochloride |
| SMILES | CC1CCCN(Cc2nccn2-c2ccccc2)C1CN.Cl |
| InChI | InChI=1S/C17H24N4.ClH/c1-14-6-5-10-20(16(14)12-18)13-17-19-9-11-21(17)15-7-3-2-4-8-15;/h2-4,7-9,11,14,16H,5-6,10,12-13,18H2,1H3;1H |
| InChIKey | PIFPRSCWBYVDDC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.87 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |