C16H22Cl2N6O3 — CID 86647412
tert-butyl (3S,4R)-3-azido-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 86647412) has the molecular formula C16H22Cl2N6O3 and a molecular weight of 417.30 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-azido-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-azido-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86647412 |
| Molecular Formula | C16H22Cl2N6O3 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | tert-butyl (3S,4R)-3-azido-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | Cc1[nH]c(C(=O)N[C@@H]2CCN(C(=O)OC(C)(C)C)C[C@@H]2N=[N+]=[N-])c(Cl)c1Cl |
| InChI | InChI=1S/C16H22Cl2N6O3/c1-8-11(17)12(18)13(20-8)14(25)21-9-5-6-24(7-10(9)22-23-19)15(26)27-16(2,3)4/h9-10,20H,5-7H2,1-4H3,(H,21,25)/t9-,10+/m1/s1 |
| InChIKey | YBIUTOLBVKAAMG-ZJUUUORDSA-N |
| XLogP | 4.05 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|