3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid

C12H24N2O2 — CID 63621092

IUPAC3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid
SMILESCCN1CCN(CC(C)(C)C(=O)O)CC1C
InChIInChI=1S/C12H24N2O2/c1-5-14-7-6-13(8-10(14)2)9-12(3,4)11(15)16/h10H,5-9H2,1-4H3,(H,15,16)
InChIKeyNWSOUYWMVMJDHV-UHFFFAOYSA-N
MW228.34 g/mol
LogP1.12
Rot. Bonds4

About 3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid

3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid (PubChem CID 63621092) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid
PubChem CID63621092
Molecular FormulaC12H24N2O2
Molecular Weight228.34 g/mol
Exact Mass228.18
IUPAC Name3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid
SMILESCCN1CCN(CC(C)(C)C(=O)O)CC1C
InChIInChI=1S/C12H24N2O2/c1-5-14-7-6-13(8-10(14)2)9-12(3,4)11(15)16/h10H,5-9H2,1-4H3,(H,15,16)
InChIKeyNWSOUYWMVMJDHV-UHFFFAOYSA-N
XLogP1.12
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.34
LogP ≤ 51.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid (CID 63621092) is 3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid is CCN1CCN(CC(C)(C)C(=O)O)CC1C.
What is the InChIKey of 3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid?
The InChIKey is NWSOUYWMVMJDHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-5-14-7-6-13(8-10(14)2)9-12(3,4)11(15)16/h10H,5-9H2,1-4H3,(H,15,16).
What are the key properties of 3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid?
3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid has a molecular weight of 228.34 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethyl-3-methylpiperazin-1-yl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 63621092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).