C10H21NO3 — CID 104959389
(2R,6S)-4-(2,2-dimethoxyethyl)-2,6-dimethylmorpholine (PubChem CID 104959389) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is (2R,6S)-4-(2,2-dimethoxyethyl)-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-(2,2-dimethoxyethyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 104959389 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | (2R,6S)-4-(2,2-dimethoxyethyl)-2,6-dimethylmorpholine |
| SMILES | COC(CN1C[C@@H](C)O[C@@H](C)C1)OC |
| InChI | InChI=1S/C10H21NO3/c1-8-5-11(6-9(2)14-8)7-10(12-3)13-4/h8-10H,5-7H2,1-4H3/t8-,9+ |
| InChIKey | NQURUCJBNHYBIW-DTORHVGOSA-N |
| XLogP | 0.71 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|