C13H26BrNO — CID 65015766
4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine (PubChem CID 65015766) has the molecular formula C13H26BrNO and a molecular weight of 292.26 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine.
| Compound Name | 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 65015766 |
| Molecular Formula | C13H26BrNO |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(CC(CBr)C(C)(C)C)CC(C)O1 |
| InChI | InChI=1S/C13H26BrNO/c1-10-7-15(8-11(2)16-10)9-12(6-14)13(3,4)5/h10-12H,6-9H2,1-5H3 |
| InChIKey | IRTUXBXSFBLEBB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|