About 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine
4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine (PubChem CID 65015766) has the molecular formula C13H26BrNO
and a molecular weight of 292.26 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine |
| PubChem CID | 65015766 |
| Molecular Formula | C13H26BrNO |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(CC(CBr)C(C)(C)C)CC(C)O1 |
| InChI | InChI=1S/C13H26BrNO/c1-10-7-15(8-11(2)16-10)9-12(6-14)13(3,4)5/h10-12H,6-9H2,1-5H3 |
| InChIKey | IRTUXBXSFBLEBB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine?
The IUPAC name of 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine (CID 65015766) is 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine.
What is the SMILES notation for 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine?
The canonical SMILES for 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine is CC1CN(CC(CBr)C(C)(C)C)CC(C)O1.
What is the InChIKey of 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine?
The InChIKey is IRTUXBXSFBLEBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26BrNO/c1-10-7-15(8-11(2)16-10)9-12(6-14)13(3,4)5/h10-12H,6-9H2,1-5H3.
What are the key properties of 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine?
4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine has a molecular weight of 292.26 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2,6-dimethylmorpholine is sourced from PubChem (CID 65015766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).