C13H26BrNO2 — CID 103537335
1-[2-(bromomethyl)-3,3-dimethylbutyl]-3,4-dimethoxypyrrolidine (PubChem CID 103537335) has the molecular formula C13H26BrNO2 and a molecular weight of 308.26 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutyl]-3,4-dimethoxypyrrolidine.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-3,4-dimethoxypyrrolidine |
|---|---|
| PubChem CID | 103537335 |
| Molecular Formula | C13H26BrNO2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-3,4-dimethoxypyrrolidine |
| SMILES | COC1CN(CC(CBr)C(C)(C)C)CC1OC |
| InChI | InChI=1S/C13H26BrNO2/c1-13(2,3)10(6-14)7-15-8-11(16-4)12(9-15)17-5/h10-12H,6-9H2,1-5H3 |
| InChIKey | UEZBBZVKLUILJW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|