C8H16BrNO2 — CID 57053898
(3S,4S)-1-(2-bromoethyl)-3,4-dimethoxypyrrolidine (PubChem CID 57053898) has the molecular formula C8H16BrNO2 and a molecular weight of 238.12 g/mol. Its IUPAC name is (3S,4S)-1-(2-bromoethyl)-3,4-dimethoxypyrrolidine.
| Compound Name | (3S,4S)-1-(2-bromoethyl)-3,4-dimethoxypyrrolidine |
|---|---|
| PubChem CID | 57053898 |
| Molecular Formula | C8H16BrNO2 |
| Molecular Weight | 238.12 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | (3S,4S)-1-(2-bromoethyl)-3,4-dimethoxypyrrolidine |
| SMILES | CO[C@H]1CN(CCBr)C[C@@H]1OC |
| InChI | InChI=1S/C8H16BrNO2/c1-11-7-5-10(4-3-9)6-8(7)12-2/h7-8H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | CNASBDMLQGCRIL-YUMQZZPRSA-N |
| XLogP | 0.73 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.12 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|