C15H31NO2S — CID 103541661
9-(3,4-dimethoxypyrrolidin-1-yl)nonane-1-thiol (PubChem CID 103541661) has the molecular formula C15H31NO2S and a molecular weight of 289.49 g/mol. Its IUPAC name is 9-(3,4-dimethoxypyrrolidin-1-yl)nonane-1-thiol.
| Compound Name | 9-(3,4-dimethoxypyrrolidin-1-yl)nonane-1-thiol |
|---|---|
| PubChem CID | 103541661 |
| Molecular Formula | C15H31NO2S |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | 9-(3,4-dimethoxypyrrolidin-1-yl)nonane-1-thiol |
| SMILES | COC1CN(CCCCCCCCCS)CC1OC |
| InChI | InChI=1S/C15H31NO2S/c1-17-14-12-16(13-15(14)18-2)10-8-6-4-3-5-7-9-11-19/h14-15,19H,3-13H2,1-2H3 |
| InChIKey | WXAUARLETROJDZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|