C10H21NO4 — CID 103536895
2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethoxy]ethanol (PubChem CID 103536895) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethoxy]ethanol.
| Compound Name | 2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethoxy]ethanol |
|---|---|
| PubChem CID | 103536895 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-[2-(3,4-dimethoxypyrrolidin-1-yl)ethoxy]ethanol |
| SMILES | COC1CN(CCOCCO)CC1OC |
| InChI | InChI=1S/C10H21NO4/c1-13-9-7-11(8-10(9)14-2)3-5-15-6-4-12/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | LTRIQETXYJWBEF-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|