C8H17Cl2NO2 — CID 69418658
(3S,4S)-1-(2-chloroethyl)-3,4-dimethoxypyrrolidine;hydrochloride (PubChem CID 69418658) has the molecular formula C8H17Cl2NO2 and a molecular weight of 230.13 g/mol. Its IUPAC name is (3S,4S)-1-(2-chloroethyl)-3,4-dimethoxypyrrolidine;hydrochloride.
| Compound Name | (3S,4S)-1-(2-chloroethyl)-3,4-dimethoxypyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 69418658 |
| Molecular Formula | C8H17Cl2NO2 |
| Molecular Weight | 230.13 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | (3S,4S)-1-(2-chloroethyl)-3,4-dimethoxypyrrolidine;hydrochloride |
| SMILES | CO[C@H]1CN(CCCl)C[C@@H]1OC.Cl |
| InChI | InChI=1S/C8H16ClNO2.ClH/c1-11-7-5-10(4-3-9)6-8(7)12-2;/h7-8H,3-6H2,1-2H3;1H/t7-,8-;/m0./s1 |
| InChIKey | WBHMWPLZJBGNEN-WSZWBAFRSA-N |
| XLogP | 0.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.13 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|