C9H18BrNO2 — CID 104959987
1-bromo-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol (PubChem CID 104959987) has the molecular formula C9H18BrNO2 and a molecular weight of 252.15 g/mol. Its IUPAC name is 1-bromo-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol.
| Compound Name | 1-bromo-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 104959987 |
| Molecular Formula | C9H18BrNO2 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 1-bromo-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol |
| SMILES | C[C@@H]1CN(CC(O)CBr)C[C@H](C)O1 |
| InChI | InChI=1S/C9H18BrNO2/c1-7-4-11(5-8(2)13-7)6-9(12)3-10/h7-9,12H,3-6H2,1-2H3/t7-,8+,9? |
| InChIKey | PWRDPNRACQIAKO-JVHMLUBASA-N |
| XLogP | 0.85 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|