C7H17N3O — CID 135371518
[(2R,6S)-2,6-dimethylmorpholin-4-yl]methylhydrazine (PubChem CID 135371518) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylmorpholin-4-yl]methylhydrazine.
| Compound Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]methylhydrazine |
|---|---|
| PubChem CID | 135371518 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]methylhydrazine |
| SMILES | C[C@@H]1CN(CNN)C[C@H](C)O1 |
| InChI | InChI=1S/C7H17N3O/c1-6-3-10(5-9-8)4-7(2)11-6/h6-7,9H,3-5,8H2,1-2H3/t6-,7+ |
| InChIKey | SRCOUDFTBOKIFY-KNVOCYPGSA-N |
| XLogP | -0.48 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|