C12H25N3O2 — CID 97355533
3-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-1,1-diethylurea (PubChem CID 97355533) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-1,1-diethylurea.
| Compound Name | 3-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 97355533 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 3-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCN1C[C@@H](C)O[C@H](C)C1 |
| InChI | InChI=1S/C12H25N3O2/c1-5-15(6-2)12(16)13-9-14-7-10(3)17-11(4)8-14/h10-11H,5-9H2,1-4H3,(H,13,16)/t10-,11-/m1/s1 |
| InChIKey | JWZDHOVGNVNEGW-GHMZBOCLSA-N |
| XLogP | 1.10 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |