C12H24ClNO — CID 104960003
(2R,6S)-4-(5-chloro-3-methylpentyl)-2,6-dimethylmorpholine (PubChem CID 104960003) has the molecular formula C12H24ClNO and a molecular weight of 233.78 g/mol. Its IUPAC name is (2R,6S)-4-(5-chloro-3-methylpentyl)-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-(5-chloro-3-methylpentyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 104960003 |
| Molecular Formula | C12H24ClNO |
| Molecular Weight | 233.78 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (2R,6S)-4-(5-chloro-3-methylpentyl)-2,6-dimethylmorpholine |
| SMILES | CC(CCCl)CCN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C12H24ClNO/c1-10(4-6-13)5-7-14-8-11(2)15-12(3)9-14/h10-12H,4-9H2,1-3H3/t10?,11-,12+ |
| InChIKey | NKCXKIHPVINFLO-YOGCLGLASA-N |
| XLogP | 2.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.78 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|