C10H22N2O2 — CID 104961406
1-amino-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]butan-2-ol (PubChem CID 104961406) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-amino-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]butan-2-ol.
| Compound Name | 1-amino-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 104961406 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-amino-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]butan-2-ol |
| SMILES | C[C@@H]1CN(CCC(O)CN)C[C@H](C)O1 |
| InChI | InChI=1S/C10H22N2O2/c1-8-6-12(7-9(2)14-8)4-3-10(13)5-11/h8-10,13H,3-7,11H2,1-2H3/t8-,9+,10? |
| InChIKey | FCGXHJVJIBMXQJ-ULKQDVFKSA-N |
| XLogP | -0.19 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |