About potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide
potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide (PubChem CID 63704106) has the molecular formula C6H12BF3KNO
and a molecular weight of 221.07 g/mol. Its IUPAC name is potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide.
Molecular Properties
| Compound Name | potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide |
| PubChem CID | 63704106 |
| Molecular Formula | C6H12BF3KNO |
| Molecular Weight | 221.07 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide |
| SMILES | F[B-](F)(F)CN1CCCOCC1.[K+] |
| InChI | InChI=1S/C6H12BF3NO.K/c8-7(9,10)6-11-2-1-4-12-5-3-11;/h1-6H2;/q-1;+1 |
| InChIKey | CESQZHBENBCGCM-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.07 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide?
The IUPAC name of potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide (CID 63704106) is potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide.
What is the SMILES notation for potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide?
The canonical SMILES for potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide is F[B-](F)(F)CN1CCCOCC1.[K+].
What is the InChIKey of potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide?
The InChIKey is CESQZHBENBCGCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12BF3NO.K/c8-7(9,10)6-11-2-1-4-12-5-3-11;/h1-6H2;/q-1;+1.
What are the key properties of potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide?
potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide has a molecular weight of 221.07 g/mol, XLogP of -1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium trifluoro(1,4-oxazepan-4-ylmethyl)boranuide is sourced from PubChem (CID 63704106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).