C14H19N3 — CID 63028473
4-(2,3-dihydroindol-1-yl)-2-(ethylamino)butanenitrile (PubChem CID 63028473) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-yl)-2-(ethylamino)butanenitrile.
| Compound Name | 4-(2,3-dihydroindol-1-yl)-2-(ethylamino)butanenitrile |
|---|---|
| PubChem CID | 63028473 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 4-(2,3-dihydroindol-1-yl)-2-(ethylamino)butanenitrile |
| SMILES | CCNC(C#N)CCN1CCc2ccccc21 |
| InChI | InChI=1S/C14H19N3/c1-2-16-13(11-15)8-10-17-9-7-12-5-3-4-6-14(12)17/h3-6,13,16H,2,7-10H2,1H3 |
| InChIKey | SDFAUAFEUXWSOI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |