C18H26N2O3S — CID 84553563
tert-butyl N-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylethyl]carbamate (PubChem CID 84553563) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84553563 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | tert-butyl N-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSCC(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C18H26N2O3S/c1-18(2,3)23-17(22)19-10-12-24-13-16(21)20-11-6-8-14-7-4-5-9-15(14)20/h4-5,7,9H,6,8,10-13H2,1-3H3,(H,19,22) |
| InChIKey | CXOSSKIHAYMHEO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|