C14H22ClN5O6 — CID 154070084
tert-butyl 6-(C-chloro-N-hydroxycarbonimidoyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-5H-1,2,4-triazine-2-carboxylate (PubChem CID 154070084) has the molecular formula C14H22ClN5O6 and a molecular weight of 391.81 g/mol. Its IUPAC name is tert-butyl 6-(C-chloro-N-hydroxycarbonimidoyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-5H-1,2,4-triazine-2-carboxylate.
| Compound Name | tert-butyl 6-(C-chloro-N-hydroxycarbonimidoyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-5H-1,2,4-triazine-2-carboxylate |
|---|---|
| PubChem CID | 154070084 |
| Molecular Formula | C14H22ClN5O6 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | tert-butyl 6-(C-chloro-N-hydroxycarbonimidoyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxo-5H-1,2,4-triazine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)NN1CC(C(Cl)=NO)=NN(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C14H22ClN5O6/c1-13(2,3)25-10(21)17-19-7-8(9(15)18-24)16-20(11(19)22)12(23)26-14(4,5)6/h24H,7H2,1-6H3,(H,17,21) |
| InChIKey | XOVDPVOCXGRRDX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|