C13H16ClN5O3 — CID 176622296
tert-butyl (4E)-4-[(5-chloropyrazin-2-yl)hydrazinylidene]-2-oxopyrrolidine-1-carboxylate (PubChem CID 176622296) has the molecular formula C13H16ClN5O3 and a molecular weight of 325.76 g/mol. Its IUPAC name is tert-butyl (4E)-4-[(5-chloropyrazin-2-yl)hydrazinylidene]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4E)-4-[(5-chloropyrazin-2-yl)hydrazinylidene]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 176622296 |
| Molecular Formula | C13H16ClN5O3 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | tert-butyl (4E)-4-[(5-chloropyrazin-2-yl)hydrazinylidene]-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C/C(=N/Nc2cnc(Cl)cn2)CC1=O |
| InChI | InChI=1S/C13H16ClN5O3/c1-13(2,3)22-12(21)19-7-8(4-11(19)20)17-18-10-6-15-9(14)5-16-10/h5-6H,4,7H2,1-3H3,(H,16,18)/b17-8+ |
| InChIKey | NJZCLSVHWWCLPS-CAOOACKPSA-N |
| XLogP | 2.07 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|