C14H17FN4O3 — CID 166837005
tert-butyl (4E)-4-[(5-fluoro-2-pyridinyl)hydrazinylidene]-2-oxopyrrolidine-1-carboxylate (PubChem CID 166837005) has the molecular formula C14H17FN4O3 and a molecular weight of 308.31 g/mol. Its IUPAC name is tert-butyl (4E)-4-[(5-fluoro-2-pyridinyl)hydrazinylidene]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4E)-4-[(5-fluoro-2-pyridinyl)hydrazinylidene]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166837005 |
| Molecular Formula | C14H17FN4O3 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | tert-butyl (4E)-4-[(5-fluoro-2-pyridinyl)hydrazinylidene]-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C/C(=N/Nc2ccc(F)cn2)CC1=O |
| InChI | InChI=1S/C14H17FN4O3/c1-14(2,3)22-13(21)19-8-10(6-12(19)20)17-18-11-5-4-9(15)7-16-11/h4-5,7H,6,8H2,1-3H3,(H,16,18)/b17-10+ |
| InChIKey | FWHZNBSSOBQOPZ-LICLKQGHSA-N |
| XLogP | 2.16 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|