C12H22ClN3O3 — CID 53273915
tert-butyl 4-(2-chloropropanoylamino)piperazine-1-carboxylate (PubChem CID 53273915) has the molecular formula C12H22ClN3O3 and a molecular weight of 291.78 g/mol. Its IUPAC name is tert-butyl 4-(2-chloropropanoylamino)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-chloropropanoylamino)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 53273915 |
| Molecular Formula | C12H22ClN3O3 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | tert-butyl 4-(2-chloropropanoylamino)piperazine-1-carboxylate |
| SMILES | CC(Cl)C(=O)NN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H22ClN3O3/c1-9(13)10(17)14-16-7-5-15(6-8-16)11(18)19-12(2,3)4/h9H,5-8H2,1-4H3,(H,14,17) |
| InChIKey | PXYHVZZTPRDILZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|